
CAS 1256821-92-7
:5-Bromo-3-ethynyl-2-fluoropyridine
Description:
5-Bromo-3-ethynyl-2-fluoropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom, a fluorine atom, and an ethynyl group. The bromine and fluorine substituents are located at the 5 and 2 positions of the pyridine ring, respectively, while the ethynyl group is attached at the 3 position. This compound exhibits properties typical of halogenated pyridines, including potential reactivity in nucleophilic substitution reactions due to the electron-withdrawing effects of the bromine and fluorine atoms. The ethynyl group contributes to its reactivity, allowing for further functionalization. 5-Bromo-3-ethynyl-2-fluoropyridine may be utilized in various applications, including medicinal chemistry and materials science, due to its unique structural features that can influence biological activity and chemical reactivity. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups.
Formula:C7H3BrFN
InChI:InChI=1S/C7H3BrFN/c1-2-5-3-6(8)4-10-7(5)9/h1,3-4H
InChI key:InChIKey=NOEWJRQYJKTEDH-UHFFFAOYSA-N
SMILES:C(#C)C1=C(F)N=CC(Br)=C1
Synonyms:- Pyridine, 5-bromo-3-ethynyl-2-fluoro-
- 5-Bromo-3-ethynyl-2-fluoropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.