
CAS 1256822-06-6
:2-Methoxy-4-(2-pyrrolidinyl)pyridine
Description:
2-Methoxy-4-(2-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted with a methoxy group and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and amines. The presence of the methoxy group can influence its solubility and reactivity, often enhancing lipophilicity. The pyrrolidine ring contributes to its potential biological activity, as it can interact with various receptors or enzymes in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to pharmacological applications. Additionally, its molecular structure suggests potential for hydrogen bonding and dipole interactions, which can affect its behavior in different solvents. Overall, 2-Methoxy-4-(2-pyrrolidinyl)pyridine is a versatile compound with potential applications in drug development and research, particularly in areas related to neurochemistry and pharmacology.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-13-10-7-8(4-6-12-10)9-3-2-5-11-9/h4,6-7,9,11H,2-3,5H2,1H3
InChI key:InChIKey=FSVCJZCLCAGHPY-UHFFFAOYSA-N
SMILES:O(C)C1=CC(=CC=N1)C2CCCN2
Synonyms:- Pyridine, 2-methoxy-4-(2-pyrrolidinyl)-
- 2-Methoxy-4-(2-pyrrolidinyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.