
CAS 1256822-07-7
:2-Pyridinecarboxylic acid, 3-chloro-4-methoxy-
Description:
2-Pyridinecarboxylic acid, 3-chloro-4-methoxy- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 2-position, a chlorine atom at the 3-position, and a methoxy group (-OCH3) at the 4-position of the pyridine ring. These substituents contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions, while the methoxy group can influence the compound's solubility and polarity. Additionally, the chlorine atom can enhance the compound's biological activity and stability. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and development in synthetic chemistry and medicinal applications.
Formula:C7H6ClNO3
InChI:InChI=1S/C7H6ClNO3/c1-12-4-2-3-9-6(5(4)8)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=MJVPNCAXAAQELP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C(OC)=CC=N1
Synonyms:- 3-Chloro-4-methoxypicolinic acid
- 3-Chloro-4-methoxypyridine-2-carboxylic acid
- 2-Pyridinecarboxylic acid, 3-chloro-4-methoxy-
- 3-Chloro-4-methoxy-pyridine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.