CAS 1256822-17-9

2-Chloro-5-(difluoromethyl)-4-pyridinecarboxylic acid

Description:

2-Chloro-5-(difluoromethyl)-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a chlorine atom and at the 5-position with a difluoromethyl group. The presence of the carboxylic acid functional group at the 4-position contributes to its acidic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly as a building block for more complex molecules. The difluoromethyl group can enhance biological activity and lipophilicity, making it of interest in medicinal chemistry. Additionally, the chlorine atom may influence the compound's reactivity and stability. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns. Overall, 2-Chloro-5-(difluoromethyl)-4-pyridinecarboxylic acid is a compound of interest in various chemical research fields.

Formula: C₇H₄ClF₂NO₂

InChI: InChI=1S/C7H4ClF2NO2/c8-5-1-3(7(12)13)4(2-11-5)6(9)10/h1-2,6H,(H,12,13)

InChI key: InChIKey=WIYWPYGJXPBUHS-UHFFFAOYSA-N

SMILES: C(F)(F)C=1C(C(O)=O)=CC(Cl)=NC1

Synonyms:

• 2-Chloro-5-(difluoromethyl)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-chloro-5-(difluoromethyl)-