CymitQuimica logo

CAS 1256823-82-1

:

5,7-Dihydro-6H-cyclopenta[b]pyridin-6-one

Description:
5,7-Dihydro-6H-cyclopenta[b]pyridin-6-one is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyridine ring fused to a cyclopentane moiety. This compound features a carbonyl group (ketone) at the 6-position of the pyridine ring, contributing to its reactivity and potential biological activity. The presence of the dihydro group indicates that the compound has two hydrogen atoms added to the ring system, which can influence its stability and interactions. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for various functional group modifications, which can enhance its activity or selectivity in biological systems. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of substituents. Overall, 5,7-Dihydro-6H-cyclopenta[b]pyridin-6-one represents a class of compounds that may have applications in drug development and materials science.
Formula:C8H7NO
InChI:InChI=1S/C8H7NO/c10-7-4-6-2-1-3-9-8(6)5-7/h1-3H,4-5H2
InChI key:InChIKey=OVHDPSLTHBMJDM-UHFFFAOYSA-N
SMILES:O=C1CC=2C(C1)=NC=CC2
Synonyms:
  • 5,7-Dihydro-6H-cyclopenta[b]pyridin-6-one
  • 6H-Cyclopenta[b]pyridin-6-one, 5,7-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.