CAS 1256824-21-1

3-[2-(4-Piperidinyl)ethyl]pyridine

Description:

3-[2-(4-Piperidinyl)ethyl]pyridine, identified by its CAS number 1256824-21-1, is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The structure features a piperidine moiety, a saturated six-membered ring containing one nitrogen atom, attached to the pyridine via an ethyl linker. This compound is typically classified as an organic base due to the presence of the nitrogen atoms in both the piperidine and pyridine rings, which can participate in protonation reactions. It may exhibit properties such as solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the piperidine group suggests possible interactions with biological targets, potentially influencing neurotransmitter systems. As with many nitrogen-containing compounds, it may also exhibit basicity and can form salts with acids. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₈N₂

InChI: InChI=1S/C12H18N2/c1-2-12(10-14-7-1)4-3-11-5-8-13-9-6-11/h1-2,7,10-11,13H,3-6,8-9H2

InChI key: InChIKey=ZBGGTPZQCAWJHO-UHFFFAOYSA-N

SMILES: C(CC=1C=CC=NC1)C2CCNCC2

Synonyms:

• Pyridine, 3-[2-(4-piperidinyl)ethyl]-
• 3-[2-(4-Piperidinyl)ethyl]pyridine

3-[2-(Piperidin-4-yl)ethyl]pyridine

CAS: 1256824-21-1

Versatile small molecule scaffold

Formula: C₁₂H₁₈N₂

Purity: Min. 95%

Molecular weight: 190.28 g/mol

Ref: 3D-GAC82421