
CAS 1256824-39-1
:6,7-Dihydro-3-methoxy-5H-pyrrolo[3,4-b]pyridine
Description:
6,7-Dihydro-3-methoxy-5H-pyrrolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyrrole moiety. This compound features a methoxy group at the 3-position and is saturated at the 6 and 7 positions, contributing to its stability and reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the structural similarities to other bioactive compounds. Its CAS number, 1256824-39-1, allows for precise identification and retrieval of information related to its properties, synthesis, and potential uses. Overall, 6,7-Dihydro-3-methoxy-5H-pyrrolo[3,4-b]pyridine is of interest for further research due to its intriguing structural features and potential therapeutic applications.
Formula:C8H10N2O
InChI:InChI=1S/C8H10N2O/c1-11-7-2-6-3-9-5-8(6)10-4-7/h2,4,9H,3,5H2,1H3
InChI key:InChIKey=RQZWBPLOLZVSLQ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=NC1)CNC2
Synonyms:- 6,7-Dihydro-3-methoxy-5H-pyrrolo[3,4-b]pyridine
- 5H-Pyrrolo[3,4-b]pyridine, 6,7-dihydro-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.