CAS 1256824-50-6

5-Chloro-N,6-dimethyl-2-pyridinamine

Description:

5-Chloro-N,6-dimethyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 5-position and two methyl groups at the 6-position of the pyridine ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its structure suggests potential reactivity, particularly in nucleophilic substitution reactions, owing to the electron-withdrawing nature of the chlorine atom. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the importance of pyridine derivatives in these fields. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 5-Chloro-N,6-dimethyl-2-pyridinamine is a notable compound within the realm of organic chemistry, with specific characteristics that may influence its reactivity and applications.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c1-5-6(8)3-4-7(9-2)10-5/h3-4H,1-2H3,(H,9,10)

InChI key: InChIKey=HKYSQTYYXRNCRV-UHFFFAOYSA-N

SMILES: N(C)C=1N=C(C)C(Cl)=CC1

Synonyms:

• 2-Pyridinamine, 5-chloro-N,6-dimethyl-
• 5-Chloro-N,6-dimethyl-2-pyridinamine