CAS 1256825-45-2

Methyl 5-hydroxy-3-pyridineacetate

Description:

Methyl 5-hydroxy-3-pyridineacetate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxyl group (-OH) at the 5-position and an acetate group (-COOCH3) at the 3-position of the pyridine ring, contributing to its chemical reactivity and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its interaction with biological systems. Methyl 5-hydroxy-3-pyridineacetate is likely to exhibit properties typical of both esters and phenolic compounds, including potential antioxidant activity. Its molecular structure suggests it could participate in various chemical reactions, such as esterification or nucleophilic substitutions. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the significance of pyridine derivatives in medicinal chemistry. However, specific data regarding its toxicity, stability, and detailed applications would require further investigation and analysis.

Formula: C₈H₉NO₃

InChI: InChI=1S/C8H9NO3/c1-12-8(11)3-6-2-7(10)5-9-4-6/h2,4-5,10H,3H2,1H3

InChI key: InChIKey=ZMDOHMDHISNKQY-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C=1C=C(O)C=NC1

Synonyms:

• Methyl 5-hydroxy-3-pyridineacetate
• 3-Pyridineacetic acid, 5-hydroxy-, methyl ester
• Methyl (5-hydroxypyridin-3-yl)acetate