
CAS 1256826-08-0
:1-(3-Chloro-5-methoxy-2-pyridinyl)ethanone
Description:
1-(3-Chloro-5-methoxy-2-pyridinyl)ethanone, identified by its CAS number 1256826-08-0, is a chemical compound characterized by its pyridine ring, which is substituted with a chlorine atom and a methoxy group. This structure contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the ethanone functional group indicates that it is a ketone, which typically exhibits properties such as being a polar compound with potential for hydrogen bonding. The chlorine substituent can enhance the compound's lipophilicity and influence its biological activity, while the methoxy group may affect its electronic properties and steric hindrance. Overall, this compound's specific characteristics, including its molecular weight, solubility, and stability, would be essential for understanding its behavior in chemical reactions and potential uses in synthesis or as an active ingredient in formulations. Further studies would be necessary to explore its full range of properties and applications.
Formula:C8H8ClNO2
InChI:InChI=1S/C8H8ClNO2/c1-5(11)8-7(9)3-6(12-2)4-10-8/h3-4H,1-2H3
InChI key:InChIKey=PDKAFVVATPBFNP-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(Cl)C=C(OC)C=N1
Synonyms:- 1-(3-Chloro-5-methoxy-2-pyridinyl)ethanone
- 1-(3-Chloro-5-methoxypyridin-2-yl)ethan-1-one
- Ethanone, 1-(3-chloro-5-methoxy-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.