
CAS 1256826-16-0
:5-Chloro-4-(trifluoromethyl)-3-pyridinecarboxaldehyde
Description:
5-Chloro-4-(trifluoromethyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a chloro substituent at the 5-position and a trifluoromethyl group at the 4-position of the pyridine ring, along with an aldehyde functional group at the 3-position. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity in various chemical reactions. The aldehyde functional group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of more complex molecules. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 1256826-16-0, uniquely identifies this specific chemical substance in chemical databases, facilitating research and regulatory processes. Overall, this compound's unique combination of functional groups and structural characteristics makes it valuable in both synthetic and applied chemistry contexts.
Formula:C7H3ClF3NO
InChI:InChI=1S/C7H3ClF3NO/c8-5-2-12-1-4(3-13)6(5)7(9,10)11/h1-3H
InChI key:InChIKey=SFZKHKZKGPWJGN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(C=O)=CN=CC1Cl
Synonyms:- 3-Pyridinecarboxaldehyde, 5-chloro-4-(trifluoromethyl)-
- 5-Chloro-4-(trifluoromethyl)-3-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Pyridinecarboxaldehyde, 5-chloro-4-(trifluoromethyl)-
CAS:Formula:C7H3ClF3NOMolecular weight:209.553
