CAS 1256826-49-9

2-Chloro-6-fluoro-4-quinolinamine

Description:

2-Chloro-6-fluoro-4-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a chlorine atom at the second position and a fluorine atom at the sixth position of the quinoline ring, along with an amino group (-NH2) at the fourth position. These substituents contribute to its unique chemical properties, including potential reactivity and biological activity. The presence of halogens (chlorine and fluorine) often enhances lipophilicity and can influence the compound's pharmacokinetics and pharmacodynamics. 2-Chloro-6-fluoro-4-quinolinamine may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in therapeutic contexts. As with many quinoline derivatives, it may also possess antimicrobial or antitumor properties, although specific biological activities would require further investigation. Safety and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₉H₆ClFN₂

InChI: InChI=1S/C9H6ClFN2/c10-9-4-7(12)6-3-5(11)1-2-8(6)13-9/h1-4H,(H2,12,13)

InChI key: InChIKey=NDGZTVRPOZTIFT-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=C(Cl)C1)C=CC(F)=C2

Synonyms:

• 2-Chloro-6-fluoro-4-quinolinamine
• 4-Quinolinamine, 2-chloro-6-fluoro-