CAS 1256834-14-6
:1-(6-Bromo-5-methyl-2-pyridinyl)ethanone
Description:
1-(6-Bromo-5-methyl-2-pyridinyl)ethanone, identified by its CAS number 1256834-14-6, is an organic compound featuring a pyridine ring substituted with a bromine atom and a methyl group. This compound exhibits characteristics typical of halogenated pyridines, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The ethanone functional group introduces a carbonyl moiety, contributing to the compound's potential as a reactive electrophile. The presence of the methyl group enhances the lipophilicity of the molecule, which may influence its solubility and biological activity. Additionally, the compound's structural features suggest it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and could vary based on purity and environmental conditions. Overall, this compound represents a versatile structure with potential applications in various chemical fields.
Formula:C8H8BrNO
InChI:InChI=1S/C8H8BrNO/c1-5-3-4-7(6(2)11)10-8(5)9/h3-4H,1-2H3
InChI key:InChIKey=AGUMKKNZBWTRFB-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1N=C(Br)C(C)=CC1
Synonyms:- 1-(6-Bromo-5-methyl-2-pyridinyl)ethanone
- Ethanone, 1-(6-bromo-5-methyl-2-pyridinyl)-
- 1-(6-Bromo-5-methylpyridin-2-yl)ethan-1-one
- 6-Acetyl-2-bromo-3-methylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
