CAS 1256834-85-1

3-Bromo-2-fluoro-5-(phenylmethoxy)pyridine

Description:

3-Bromo-2-fluoro-5-(phenylmethoxy)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom at the 3-position, a fluorine atom at the 2-position, and a phenylmethoxy group at the 5-position. This compound exhibits properties typical of halogenated pyridines, including potential reactivity due to the presence of the bromine and fluorine substituents, which can influence its electronic properties and steric hindrance. The phenylmethoxy group contributes to its lipophilicity, potentially enhancing its solubility in organic solvents. The presence of both bromine and fluorine can also impart unique chemical reactivity, making it of interest in various synthetic applications, including medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which could be explored in drug development. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.

Formula: C₁₂H₉BrFNO

InChI: InChI=1S/C12H9BrFNO/c13-11-6-10(7-15-12(11)14)16-8-9-4-2-1-3-5-9/h1-7H,8H2

InChI key: InChIKey=XHISURUYSXQYLR-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C=2C=C(Br)C(F)=NC2

Synonyms:

• Pyridine, 3-bromo-2-fluoro-5-(phenylmethoxy)-
• 3-Bromo-2-fluoro-5-(phenylmethoxy)pyridine