CymitQuimica logo

CAS 1256835-57-0

:

4-Chloro-3-methyl-1H-pyrazolo[3,4-b]pyridine

Description:
4-Chloro-3-methyl-1H-pyrazolo[3,4-b]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. This compound features a chlorine atom at the 4-position and a methyl group at the 3-position of the pyrazole ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can enhance its lipophilicity, potentially affecting its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyrazolo-pyridine structures have been explored for various pharmacological activities. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 4-Chloro-3-methyl-1H-pyrazolo[3,4-b]pyridine represents a valuable scaffold in the search for new therapeutic agents.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c1-4-6-5(8)2-3-9-7(6)11-10-4/h2-3H,1H3,(H,9,10,11)
InChI key:InChIKey=BZXYNBAOCRICRN-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1)NN=C2C
Synonyms:
  • 4-Chloro-3-methyl-1H-pyrazolo[3,4-b]pyridine
  • 1H-Pyrazolo[3,4-b]pyridine, 4-chloro-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.