CymitQuimica logo

CAS 1256835-58-1

:

5-Fluoro-4-methoxy-2-pyridinecarboxaldehyde

Description:
5-Fluoro-4-methoxy-2-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a methoxy group at the 4-position contributes to its unique chemical properties, influencing its reactivity and potential applications in various fields, including medicinal chemistry and agrochemicals. The aldehyde functional group at the 2-position makes it a versatile intermediate for further chemical transformations, allowing for the synthesis of more complex molecules. This compound is typically a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. Its solubility in organic solvents and moderate stability under standard conditions make it suitable for various synthetic applications. Additionally, the presence of both electron-withdrawing (fluoro) and electron-donating (methoxy) groups can significantly affect its electronic properties, making it an interesting subject for studies related to structure-activity relationships in drug design.
Formula:C7H6FNO2
InChI:InChI=1S/C7H6FNO2/c1-11-7-2-5(4-10)9-3-6(7)8/h2-4H,1H3
InChI key:InChIKey=GBTCYPXLIAVUDA-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=O)N=CC1F
Synonyms:
  • 5-Fluoro-4-methoxy-2-pyridinecarboxaldehyde
  • 2-Pyridinecarboxaldehyde, 5-fluoro-4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.