CAS 1256835-72-9

6-Chloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine

Description:

6-Chloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates a chlorine atom and a trifluoromethyl group. This compound typically exhibits a pale yellow to off-white solid appearance and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties. Its chlorine substituent may also contribute to its reactivity and interaction with biological targets. The compound is soluble in organic solvents, which is common for many heterocycles, but its solubility in water is generally limited. As with many chemical substances, safety data should be consulted, as it may pose hazards such as toxicity or environmental impact. Overall, 6-Chloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine represents a class of compounds that are valuable in research and development, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₇H₃ClF₃N₃

InChI: InChI=1S/C7H3ClF3N3/c8-4-2-1-3-5(7(9,10)11)13-14-6(3)12-4/h1-2H,(H,12,13,14)

InChI key: InChIKey=PJYSQLKJDPKTKR-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=2C(NN1)=NC(Cl)=CC2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine, 6-chloro-3-(trifluoromethyl)-
• 6-Chloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine