CymitQuimica logo

CAS 1256837-00-9

:

Methyl 2-bromo-5-hydroxy-3-pyridinecarboxylate

Description:
Methyl 2-bromo-5-hydroxy-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a hydroxyl group at the 5-position contributes to its reactivity and potential applications in organic synthesis. The carboxylate group, derived from the carboxylic acid, is esterified with a methyl group, enhancing its solubility in organic solvents. This compound may exhibit biological activity due to the functional groups present, making it of interest in medicinal chemistry. Its structure suggests potential for further derivatization, which could lead to the development of novel pharmaceuticals or agrochemicals. Additionally, the presence of the bromine atom may facilitate nucleophilic substitution reactions, while the hydroxyl group can participate in hydrogen bonding, influencing its physical properties such as boiling point and solubility. Overall, Methyl 2-bromo-5-hydroxy-3-pyridinecarboxylate is a versatile compound with significant implications in chemical research and development.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-7(11)5-2-4(10)3-9-6(5)8/h2-3,10H,1H3
InChI key:InChIKey=NMYPZBWLPGSJNE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(Br)N=CC(O)=C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 2-bromo-5-hydroxy-, methyl ester
  • Methyl 2-bromo-5-hydroxy-3-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.