CAS 125686-91-1

8-Hydroxy-2-quinolinecarbonyl chloride

Description:

8-Hydroxy-2-quinolinecarbonyl chloride, with the CAS number 125686-91-1, is a chemical compound characterized by its quinoline structure, which features a hydroxyl group at the 8-position and a carbonyl chloride functional group. This compound is typically used in organic synthesis, particularly in the preparation of various derivatives and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its reactivity is largely attributed to the presence of the carbonyl chloride group, which can undergo nucleophilic substitution reactions. The hydroxyl group contributes to its potential as a chelating agent, allowing it to form complexes with metal ions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. It is important to handle this substance with care, as carbonyl chlorides can be corrosive and may pose health risks if inhaled or ingested. Proper safety protocols should be followed when working with this compound in a laboratory setting.

Formula: C₁₀H₆ClNO₂

InChI: InChI=1S/C10H6ClNO2/c11-10(14)7-5-4-6-2-1-3-8(13)9(6)12-7/h1-5,13H

InChI key: InChIKey=MLUUBRFEMCGPCV-UHFFFAOYSA-N

SMILES: OC=1C2=C(C=CC(C(Cl)=O)=N2)C=CC1

Synonyms:

• 8-Hydroxy-2-quinolinecarbonyl chloride
• 2-Quinolinecarbonyl chloride, 8-hydroxy-