CAS 125687-18-5
:(2,3,4,5,6-pentadeuteriophenyl)hydrazine
Description:
(2,3,4,5,6-pentadeuteriophenyl)hydrazine is a deuterated derivative of phenylhydrazine, characterized by the substitution of five hydrogen atoms on the phenyl ring with deuterium, a stable isotope of hydrogen. This modification enhances its utility in various analytical applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where deuteration reduces background signals and improves spectral clarity. The compound features a hydrazine functional group, which is known for its reactivity, particularly in forming azo compounds and as a reducing agent. Its chemical structure contributes to its potential applications in organic synthesis and as a reagent in biochemical assays. The presence of deuterium can also influence the physical properties, such as boiling and melting points, compared to its non-deuterated counterpart. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the deuterated phenyl group, making it a valuable tool in research involving isotopic labeling and mechanistic studies in organic chemistry.
Formula:C6H4ClD5N2
InChI:InChI=1/C6H8N2/c7-8-6-4-2-1-3-5-6/h1-5,8H,7H2/i1D,2D,3D,4D,5D
SMILES:c1(c(c(c(c(c1[2H])[2H])NN)[2H])[2H])[2H]
Synonyms:- Phenylhydrazine-d5 Hydrochloride (Major)
- Phenyl-d5-hydrazine Hydrochloride
- Phenylhydrazine-d5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Phenylhydrazine-d5 Hydrochloride (Major)
CAS:Controlled ProductFormula:C6H4D5ClN2Color and Shape:Off WhiteMolecular weight:149.63

