
CAS 1256955-29-9
:4,7-Dichloro-6-iodoquinazoline
Description:
4,7-Dichloro-6-iodoquinazoline is a heterocyclic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. This compound features two chlorine atoms and one iodine atom substituted at specific positions on the quinazoline ring, contributing to its unique chemical properties. The presence of halogen substituents often enhances the compound's reactivity and can influence its biological activity, making it of interest in medicinal chemistry. Typically, compounds like 4,7-Dichloro-6-iodoquinazoline may exhibit properties such as moderate to high solubility in organic solvents, while their stability can vary depending on environmental conditions. Additionally, the compound may possess potential applications in pharmaceuticals, particularly in the development of targeted therapies, due to its structural characteristics that can interact with biological targets. Safety and handling precautions are essential when working with halogenated compounds, as they may pose health risks or environmental hazards.
Formula:C8H3Cl2IN2
InChI:InChI=1S/C8H3Cl2IN2/c9-5-2-7-4(1-6(5)11)8(10)13-3-12-7/h1-3H
InChI key:InChIKey=ZAMPZNQZEXEDBG-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(Cl)C(I)=C2)N=CN1
Synonyms:- Quinazoline, 4,7-dichloro-6-iodo-
- 4,7-Dichloro-6-iodoquinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.