
CAS 1256955-38-0
:4-Chloro-6-cyclopropyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
Description:
4-Chloro-6-cyclopropyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyrrole and pyrimidine rings. The presence of a chlorine atom at the 4-position and a cyclopropyl group at the 6-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen-containing rings that can interact with biological targets. The compound's reactivity may be influenced by the electron-withdrawing nature of the chlorine substituent and the strain of the cyclopropyl group, which can affect its stability and reactivity in various chemical reactions. Overall, 4-Chloro-6-cyclopropyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine represents a class of compounds of interest for further research in drug discovery and development.
Formula:C9H10ClN3
InChI:InChI=1S/C9H10ClN3/c10-9-7-3-13(6-1-2-6)4-8(7)11-5-12-9/h5-6H,1-4H2
InChI key:InChIKey=QLNXAMTXQWZUKJ-UHFFFAOYSA-N
SMILES:ClC1=C2CN(CC2=NC=N1)C3CC3
Synonyms:- 5H-Pyrrolo[3,4-d]pyrimidine, 4-chloro-6-cyclopropyl-6,7-dihydro-
- 4-Chloro-6-cyclopropyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.