CymitQuimica logo

CAS 1256955-39-1

:

4-Chloro-6,7-dihydro-6-(4-methylphenyl)-5H-pyrrolo[3,4-d]pyrimidine

Description:
4-Chloro-6,7-dihydro-6-(4-methylphenyl)-5H-pyrrolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyrrole and pyrimidine rings. The presence of a chlorine atom at the 4-position and a 4-methylphenyl group at the 6-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can interact with biological targets. The compound may also exhibit interesting electronic properties due to the conjugated system formed by the fused rings. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, making it a versatile building block in organic synthesis.
Formula:C13H12ClN3
InChI:InChI=1S/C13H12ClN3/c1-9-2-4-10(5-3-9)17-6-11-12(7-17)15-8-16-13(11)14/h2-5,8H,6-7H2,1H3
InChI key:InChIKey=MBZJZZYADKCXAV-UHFFFAOYSA-N
SMILES:ClC1=C2CN(CC2=NC=N1)C3=CC=C(C)C=C3
Synonyms:
  • 4-Chloro-6,7-dihydro-6-(4-methylphenyl)-5H-pyrrolo[3,4-d]pyrimidine
  • 5H-Pyrrolo[3,4-d]pyrimidine, 4-chloro-6,7-dihydro-6-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.