CAS 1256955-52-8

4-Chloro-5,6,7,8-tetrahydro-8,8-dimethylquinazoline

Description:

4-Chloro-5,6,7,8-tetrahydro-8,8-dimethylquinazoline is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 4-position and two methyl groups at the 8-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its tetrahydro configuration indicates that it contains a saturated ring system, which can influence its reactivity and interactions with biological systems. The compound may be of interest in medicinal chemistry due to its potential biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. As with many organic compounds, safety data should be consulted, as it may pose hazards such as toxicity or environmental impact. Overall, 4-Chloro-5,6,7,8-tetrahydro-8,8-dimethylquinazoline represents a class of compounds that can be explored for various applications in pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₃ClN₂

InChI: InChI=1S/C10H13ClN2/c1-10(2)5-3-4-7-8(10)12-6-13-9(7)11/h6H,3-5H2,1-2H3

InChI key: InChIKey=BXTZXVIRLWWPQL-UHFFFAOYSA-N

SMILES: ClC1=C2C(C(C)(C)CCC2)=NC=N1

Synonyms:

• Quinazoline, 4-chloro-5,6,7,8-tetrahydro-8,8-dimethyl-
• 4-Chloro-5,6,7,8-tetrahydro-8,8-dimethylquinazoline