
CAS 1256955-56-2
:4-Chloro-5,6-dihydro-6,6-dimethylquinazoline
Description:
4-Chloro-5,6-dihydro-6,6-dimethylquinazoline is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 4-position and two methyl groups at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential reactivity due to the presence of the chlorine substituent, which can participate in nucleophilic substitution reactions. The dihydro form indicates that it has two hydrogen atoms added to the quinazoline ring, which may influence its stability and reactivity. Compounds of this class are often studied for their biological activities, including potential pharmaceutical applications. However, specific information regarding its toxicity, environmental impact, and detailed reactivity would require further investigation and analysis. Overall, 4-Chloro-5,6-dihydro-6,6-dimethylquinazoline represents a compound of interest in both synthetic and medicinal chemistry.
Formula:C10H11ClN2
InChI:InChI=1S/C10H11ClN2/c1-10(2)4-3-8-7(5-10)9(11)13-6-12-8/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=ZGOIZQKYAZNVFI-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=CC(C)(C)C2)=NC=N1
Synonyms:- 4-Chloro-5,6-dihydro-6,6-dimethylquinazoline
- Quinazoline, 4-chloro-5,6-dihydro-6,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.