CymitQuimica logo

CAS 1256955-64-2

:

4-Chloro-5-methyl-6-(1-methylethyl)pyrimidine

Description:
4-Chloro-5-methyl-6-(1-methylethyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a methyl group at the 5-position contributes to its reactivity and potential applications in various chemical reactions. The isopropyl group at the 6-position enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal compounds. Its molecular structure suggests potential for substitution reactions, and its unique functional groups may allow for specific interactions with enzymes or receptors. As with many pyrimidine derivatives, it may also participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H11ClN2
InChI:InChI=1S/C8H11ClN2/c1-5(2)7-6(3)8(9)11-4-10-7/h4-5H,1-3H3
InChI key:InChIKey=LURVASRCMCNIQQ-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C(C)=C(Cl)N=CN1
Synonyms:
  • Pyrimidine, 4-chloro-5-methyl-6-(1-methylethyl)-
  • 4-Chloro-5-methyl-6-(1-methylethyl)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.