CAS 1256957-73-9

5-Bromo-3-(ethylsulfonyl)-2-pyridinamine

Description:

5-Bromo-3-(ethylsulfonyl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a bromine atom, an ethylsulfonyl group, and a pyridinamine moiety. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its potential biological activity. The presence of the bromine atom introduces halogenation, which can influence the compound's reactivity and solubility. The ethylsulfonyl group enhances the compound's polar characteristics, potentially improving its solubility in polar solvents. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further studies, including its interaction with biological targets and its overall pharmacokinetic profile. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the bromine atom, which can pose health risks. Overall, 5-Bromo-3-(ethylsulfonyl)-2-pyridinamine represents a versatile structure for further exploration in chemical and pharmaceutical research.

Formula: C₇H₉BrN₂O₂S

InChI: InChI=1S/C7H9BrN2O2S/c1-2-13(11,12)6-3-5(8)4-10-7(6)9/h3-4H,2H2,1H3,(H2,9,10)

InChI key: InChIKey=QLMVDZRCXNXRLD-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C1=C(N)N=CC(Br)=C1

Synonyms:

• 2-Pyridinamine, 5-bromo-3-(ethylsulfonyl)-
• 5-Bromo-3-(ethylsulfonyl)-2-pyridinamine