CAS 1256961-21-3

2-Ethyl-2,3-dihydro-4-nitro-1H-isoindol-1-one

Description:

2-Ethyl-2,3-dihydro-4-nitro-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a bicyclic framework consisting of a benzene ring fused to a five-membered nitrogen-containing ring. This compound contains a nitro group (-NO2) and an ethyl group (-C2H5) that contribute to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. The dihydro form indicates that the compound has two hydrogen atoms added to the isoindole structure, which may influence its stability and reactivity. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific physical properties, such as solubility, melting point, and boiling point, would need to be determined experimentally, as they are not universally defined and can vary based on environmental conditions and purity.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c1-2-11-6-8-7(10(11)13)4-3-5-9(8)12(14)15/h3-5H,2,6H2,1H3

InChI key: InChIKey=MTCQWJLNHOOGTI-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(C(=O)N(CC)C2)=CC=C1

Synonyms:

• 2-Ethyl-4-nitro-2,3-dihydro-1H-isoindol-1-one
• 2-Ethyl-2,3-dihydro-4-nitro-1H-isoindol-1-one
• 1H-Isoindol-1-one, 2-ethyl-2,3-dihydro-4-nitro-
• 2-Ethyl-4-nitro-2,3-dihydro-isoindol-1-one