CAS 125699-00-5
:5-trifluoromethylthioribose
Description:
5-Trifluoromethylthioribose is a modified sugar molecule that features a ribose backbone with a trifluoromethyl group and a thiol (-SH) substituent. This compound is characterized by its unique structural modifications, which enhance its biochemical properties and potential applications in medicinal chemistry and biochemistry. The trifluoromethyl group is known for its electron-withdrawing effects, which can influence the reactivity and stability of the molecule, while the thiol group can participate in various chemical reactions, including redox processes and the formation of disulfide bonds. The presence of these functional groups may also affect the compound's solubility, polarity, and interaction with biological targets, making it of interest in the development of antiviral agents or nucleoside analogs. Additionally, the compound's specific stereochemistry and conformation can play a crucial role in its biological activity and interactions with enzymes or receptors. Overall, 5-trifluoromethylthioribose represents a significant area of study in the field of chemical biology and drug design.
Formula:C6H9F3O4S
InChI:InChI=1/C6H9F3O4S/c7-6(8,9)5(13)4(12)3(11)2(10)1-14/h1-5,10-13H/t2-,3-,4-,5?/m0/s1
SMILES:C(=S)[C@@H]([C@@H]([C@@H](C(C(F)(F)F)O)O)O)O
Synonyms:- Tfmtr
- D-Ribose, 5-thio-5-S-(trifluoromethyl)-
- (5xi)-6-deoxy-6,6,6-trifluoro-1-thio-D-ribo-hexose
- 5-Trifluoromethylthioribose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
