
CAS 1257046-03-9
:1,1-Dimethylethyl N-[1-(tetrahydro-3-furanyl)-3-azetidinyl]carbamate
Description:
1,1-Dimethylethyl N-[1-(tetrahydro-3-furanyl)-3-azetidinyl]carbamate, identified by its CAS number 1257046-03-9, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a tetrahydrofuran moiety. This compound is likely to exhibit properties typical of carbamates, such as potential biological activity, which may include insecticidal or herbicidal effects, depending on its specific application. The presence of the azetidine ring suggests that it may possess interesting pharmacological properties, as azetidines are often found in various bioactive molecules. Additionally, the dimethyl group contributes to steric hindrance, which can influence the compound's reactivity and interaction with biological targets. The compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular structure. As with many synthetic organic compounds, safety and handling precautions are essential, particularly in laboratory or industrial settings, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C12H22N2O3
InChI:InChI=1S/C12H22N2O3/c1-12(2,3)17-11(15)13-9-6-14(7-9)10-4-5-16-8-10/h9-10H,4-8H2,1-3H3,(H,13,15)
InChI key:InChIKey=KGERMUANACSNAO-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1CN(C1)C2CCOC2
Synonyms:- tert-Butyl [1-(tetrahydrofuran-3-yl)azetidin-3-yl]carbamate
- Carbamic acid, N-[1-(tetrahydro-3-furanyl)-3-azetidinyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[1-(tetrahydro-3-furanyl)-3-azetidinyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.