CAS 1257081-00-7

2-[2-[(Phenylmethyl)amino]ethoxy]acetic acid

Description:

2-[2-[(Phenylmethyl)amino]ethoxy]acetic acid, identified by its CAS number 1257081-00-7, is a chemical compound characterized by its unique structure that includes an ethoxy group and an amino group attached to a phenylmethyl moiety. This compound typically exhibits properties associated with both amino acids and ether functionalities, which may influence its solubility and reactivity. It is likely to be a polar molecule due to the presence of the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The phenylmethyl group may contribute to hydrophobic interactions, affecting its overall behavior in biological systems. This compound could potentially have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may interact with biological targets. However, specific biological activity, toxicity, and detailed physicochemical properties would require further investigation through experimental studies and literature review.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c13-11(14)9-15-7-6-12-8-10-4-2-1-3-5-10/h1-5,12H,6-9H2,(H,13,14)

InChI key: InChIKey=NJDWFKRXCVPXEK-UHFFFAOYSA-N

SMILES: C(NCCOCC(O)=O)C1=CC=CC=C1

Synonyms:

• Acetic acid, 2-[2-[(phenylmethyl)amino]ethoxy]-
• 2-[2-[(Phenylmethyl)amino]ethoxy]acetic acid

(2-Benzylamino-ethoxy)-acetic acid

CAS: 1257081-00-7

Formula: C₁₁H₁₅NO₃

Molecular weight: 209.245

Ref: 10-F330223