CAS 1257106-74-3

4-Pyrimidinemethanamine, α-methyl-, hydrochloride (1:2)

Description:

4-Pyrimidinemethanamine, α-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) attached to a methylene (-CH2-) group, which is further substituted with an α-methyl group, enhancing its basicity and potential for hydrogen bonding. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically increases its solubility in water and stability. This substance may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. Its properties, such as melting point, solubility, and reactivity, can be influenced by the presence of the hydrochloride salt. As with many nitrogen-containing compounds, it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Safety and handling precautions should be observed due to its potential biological effects.

Formula: C₆H₉N₃·2ClH

InChI: InChI=1S/C6H9N3.2ClH/c1-5(7)6-2-3-8-4-9-6;;/h2-5H,7H2,1H3;2*1H

InChI key: InChIKey=XPVFVFAOQUGQDG-UHFFFAOYSA-N

SMILES: C(C)(N)C=1C=CN=CN1.Cl

Synonyms:

• 4-Pyrimidinemethanamine, α-methyl-, hydrochloride (1:2)
• 1-(Pyrimidin-4-yl)ethanamine dihydrochloride

1-(Pyrimidin-4-yl)ethanamine dihydrochloride

CAS: 1257106-74-3

Formula: C₆H₁₁Cl₂N₃

Purity: 95%

Molecular weight: 196.0776

Ref: IN-DA000OJC

[1-(4-Pyrimidinyl)ethyl]amine dihydrochloride

CAS: 1257106-74-3

Versatile small molecule scaffold

Formula: C₆H₁₁Cl₂N₃

Purity: Min. 95%

Molecular weight: 196.07 g/mol

Ref: 3D-HAC10674