CAS 1257122-37-4

6-Chloro-1-methyl-1H-indole-3-carboxylic acid

Description:

6-Chloro-1-methyl-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 6-position and a carboxylic acid functional group at the 3-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The chlorine substituent can influence the compound's electronic properties and biological activity, making it a subject of interest in medicinal chemistry. Additionally, the methyl group at the 1-position can affect the steric and electronic characteristics of the molecule, potentially impacting its interactions with biological targets. Overall, 6-Chloro-1-methyl-1H-indole-3-carboxylic acid is a versatile compound with applications in various fields of chemical research.

Formula: C₁₀H₈ClNO₂

InChI: InChI=1S/C10H8ClNO2/c1-12-5-8(10(13)14)7-3-2-6(11)4-9(7)12/h2-5H,1H3,(H,13,14)

InChI key: InChIKey=UMVCXQBKCZPXCR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(N(C)C1)=CC(Cl)=CC2

Synonyms:

• 6-Chloro-1-methyl-1H-indole-3-carboxylic acid
• 6-Chloro-1-methyl-3-indolecarboxylic acid
• 1H-Indole-3-carboxylic acid, 6-chloro-1-methyl-

6-Chloro-1-methyl-1H-indole-3-carboxylic acid

Controlled Product

CAS: 1257122-37-4

Versatile small molecule scaffold

Formula: C₁₀H₈ClNO₂

Purity: Min. 95%

Molecular weight: 209.63 g/mol

Ref: 3D-HAC12237