CymitQuimica logo

CAS 125721-82-6

:

2,6-dimethyl-4-(2-(2-thienyl)ethenyl)phenol

Description:
2,6-Dimethyl-4-(2-(2-thienyl)ethenyl)phenol, with the CAS number 125721-82-6, is an organic compound characterized by its complex structure, which includes a phenolic group and a thienyl substituent. This compound features a phenol ring substituted at the 2 and 6 positions with methyl groups, enhancing its hydrophobic properties. The presence of the thienyl group, which is a five-membered aromatic ring containing sulfur, contributes to its unique electronic properties and potential reactivity. The ethenyl group introduces a double bond, which can participate in various chemical reactions, such as polymerization or electrophilic addition. This compound may exhibit interesting biological activities, making it of interest in fields such as medicinal chemistry or materials science. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 2,6-dimethyl-4-(2-(2-thienyl)ethenyl)phenol is a versatile compound with potential applications in various chemical and industrial processes.
Formula:C14H14OS
InChI:InChI=1/C14H14OS/c1-10-8-12(9-11(2)14(10)15)5-6-13-4-3-7-16-13/h3-9,15H,1-2H3/b6-5+
Synonyms:
  • 2,6-Dimethyl-4-(2-(2-thienyl)ethenyl)phenol
  • 2,6-dimethyl-4-[(E)-2-thiophen-2-ylethenyl]phenol
  • BI-L-226
  • Phenol, 2,6-dimethyl-4-(2-(2-thienyl)ethenyl)-
  • BI-L 226
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.