CAS 125722-16-9
:2,6-dimethyl-4-(2-(4-fluorophenyl)ethenyl)phenol
Description:
2,6-Dimethyl-4-(2-(4-fluorophenyl)ethenyl)phenol, with the CAS number 125722-16-9, is an organic compound characterized by its complex structure, which includes a phenolic group and a fluorinated aromatic substituent. This compound features a dimethyl substitution at the 2 and 6 positions of the phenolic ring, enhancing its lipophilicity and potentially influencing its reactivity and solubility. The presence of the 4-fluorophenyl group introduces electron-withdrawing characteristics, which can affect the compound's electronic properties and reactivity. As a phenolic compound, it may exhibit antioxidant properties and can participate in various chemical reactions, including electrophilic substitutions. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, particularly in the development of compounds with specific biological activities or as intermediates in synthetic pathways. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C16H15FO
InChI:InChI=1/C16H15FO/c1-11-9-14(10-12(2)16(11)18)4-3-13-5-7-15(17)8-6-13/h3-10,18H,1-2H3
SMILES:Cc1cc(C=Cc2ccc(cc2)F)cc(C)c1O
Synonyms:- Bi-L 239
- Phenol, 4-(2-(4-fluorophenyl)ethenyl)-2,6-dimethyl-, (E)-
- 4-[2-(4-Fluorophenyl)Vinyl]-2,6-Dimethyl-Phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BI-L 239
CAS:BI-L 239 is an inhibition of 5-lipoxygenase products that cause bronchoconstriction.Formula:C16H15FOColor and Shape:SolidMolecular weight:242.29
