CymitQuimica logo

CAS 125722-33-0

:

1-[2,6-Dimethyl-4-[2-(2-thienyl)ethenyl]phenyl] butanedioate

Description:
1-[2,6-Dimethyl-4-[2-(2-thienyl)ethenyl]phenyl] butanedioate, with the CAS number 125722-33-0, is an organic compound characterized by its complex structure that includes a butanedioate moiety and a phenyl ring substituted with both dimethyl and thienyl groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for pi-pi interactions due to its conjugated system. The presence of the thienyl group introduces heteroatoms into the structure, which can influence its reactivity and solubility in various solvents. Additionally, the dimethyl substitutions on the phenyl ring can affect steric hindrance and electronic properties, potentially impacting its behavior in chemical reactions and applications. Such compounds may be of interest in fields like organic synthesis, materials science, or pharmaceuticals, where their unique structural features can lead to specific functional properties. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications.
Formula:C18H18O4S
InChI:InChI=1S/C18H18O4S/c1-12-10-14(5-6-15-4-3-9-23-15)11-13(2)18(12)22-17(21)8-7-16(19)20/h3-6,9-11H,7-8H2,1-2H3,(H,19,20)
InChI key:InChIKey=OIDYLVFJAIPWBI-UHFFFAOYSA-N
SMILES:O(C(CCC(O)=O)=O)C1=C(C)C=C(C=CC2=CC=CS2)C=C1C
Synonyms:
  • 1-[2,6-Dimethyl-4-[2-(2-thienyl)ethenyl]phenyl] butanedioate
  • Butanedioic acid, mono[2,6-dimethyl-4-[2-(2-thienyl)ethenyl]phenyl] ester
  • Butanedioic acid, 1-[2,6-dimethyl-4-[2-(2-thienyl)ethenyl]phenyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.