CAS 1257266-94-6

Ethyl 2-ethyl-5-oxazolecarboxylate

Description:

Ethyl 2-ethyl-5-oxazolecarboxylate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features an ethyl group attached to the oxazole ring, contributing to its overall hydrophobic character. The carboxylate functional group enhances its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitutions. Ethyl 2-ethyl-5-oxazolecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents suggests it can be utilized in organic synthesis and pharmaceutical applications. Additionally, the presence of the oxazole moiety may impart biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, this compound exemplifies the diverse chemistry associated with heterocyclic compounds and their derivatives.

Formula: C₈H₁₁NO₃

InChI: InChI=1S/C8H11NO3/c1-3-7-9-5-6(12-7)8(10)11-4-2/h5H,3-4H2,1-2H3

InChI key: InChIKey=CIWFKCUZQXHNKW-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1OC(CC)=NC1

Synonyms:

• Ethyl 2-ethyl-5-oxazolecarboxylate
• 5-Oxazolecarboxylic acid, 2-ethyl-, ethyl ester