CymitQuimica logo

CAS 1257293-70-1

:

4-(3-Azetidinyl)-2-piperazinone

Description:
4-(3-Azetidinyl)-2-piperazinone is a chemical compound characterized by its unique bicyclic structure, which includes a piperazinone ring and an azetidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in polar solvents. The presence of nitrogen atoms in its structure suggests that it may engage in hydrogen bonding, influencing its reactivity and interaction with biological targets. It may also possess pharmacological properties, making it of interest in medicinal chemistry for the development of therapeutic agents. The molecular framework allows for various functional group modifications, which can enhance its efficacy or selectivity in biological applications. As with many compounds in this class, stability under standard conditions is expected, but specific handling and storage recommendations should be followed to maintain its integrity. Overall, 4-(3-Azetidinyl)-2-piperazinone represents a versatile scaffold for further chemical exploration and potential drug development.
Formula:C7H13N3O
InChI:InChI=1S/C7H13N3O/c11-7-5-10(2-1-9-7)6-3-8-4-6/h6,8H,1-5H2,(H,9,11)
InChI key:InChIKey=APQXTYBDGHVRLL-UHFFFAOYSA-N
SMILES:O=C1CN(CCN1)C2CNC2
Synonyms:
  • 4-(Azetidin-3-yl)piperazin-2-one
  • 4-(3-Azetidinyl)-2-piperazinone
  • 2-Piperazinone, 4-(3-azetidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.