CAS 1257294-08-8
:1-(3-Azetidinyl)-3,3-difluoropyrrolidine
Description:
1-(3-Azetidinyl)-3,3-difluoropyrrolidine is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and an azetidine moiety. The presence of two fluorine atoms at the 3-position of the pyrrolidine ring contributes to its distinct reactivity and potential biological activity. This compound is typically classified as a nitrogen-containing heterocycle, which often exhibits interesting pharmacological properties. The azetidine ring adds to its complexity, potentially influencing its interaction with biological targets. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of electron-withdrawing fluorine atoms. Additionally, its specific stereochemistry can affect its binding affinity and selectivity in biological systems. Overall, 1-(3-Azetidinyl)-3,3-difluoropyrrolidine represents a class of compounds that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C7H12F2N2
InChI:InChI=1S/C7H12F2N2/c8-7(9)1-2-11(5-7)6-3-10-4-6/h6,10H,1-5H2
InChI key:InChIKey=XHHYGYVKHQAJTJ-UHFFFAOYSA-N
SMILES:FC1(F)CN(CC1)C2CNC2
Synonyms:- Pyrrolidine, 1-(3-azetidinyl)-3,3-difluoro-
- 1-(3-Azetidinyl)-3,3-difluoropyrrolidine
- 1-(Azetidin-3-yl)-3,3-difluoropyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.