CAS 1257294-44-2

4-Bromo-6-methyl-1H-pyrrolo[3,2-c]pyridine

Description:

4-Bromo-6-methyl-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 4-position and a methyl group at the 6-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale to dark solid appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its heteroatom content can influence its electronic properties, potentially affecting its interactions with biological targets. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts. Overall, 4-Bromo-6-methyl-1H-pyrrolo[3,2-c]pyridine represents a significant compound in the field of organic chemistry and drug development.

Formula: C₈H₇BrN₂

InChI: InChI=1S/C8H7BrN2/c1-5-4-7-6(2-3-10-7)8(9)11-5/h2-4,10H,1H3

InChI key: InChIKey=YATLEQZDSCLWMR-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(C)=N1)NC=C2

Synonyms:

• 4-Bromo-6-methyl-1H-pyrrolo[3,2-c]pyridine
• 1H-Pyrrolo[3,2-c]pyridine, 4-bromo-6-methyl-