CymitQuimica logo

CAS 1257294-52-2

:

5-Bromo-8-(phenylmethoxy)imidazo[1,2-a]pyridine

Description:
5-Bromo-8-(phenylmethoxy)imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine core, which is a bicyclic structure containing both nitrogen and carbon atoms. The presence of a bromine atom at the 5-position and a phenylmethoxy group at the 8-position contributes to its unique chemical properties and potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the phenylmethoxy substituent, which can influence its solubility and permeability in biological systems. Additionally, the imidazo[1,2-a]pyridine framework is known for its involvement in various pharmacological activities, making such compounds of interest in medicinal chemistry. The bromine substituent may also enhance reactivity in certain chemical reactions, such as nucleophilic substitutions or coupling reactions. Overall, 5-Bromo-8-(phenylmethoxy)imidazo[1,2-a]pyridine represents a class of compounds that may have applications in drug development and other fields of chemical research.
Formula:C14H11BrN2O
InChI:InChI=1S/C14H11BrN2O/c15-13-7-6-12(14-16-8-9-17(13)14)18-10-11-4-2-1-3-5-11/h1-9H,10H2
InChI key:InChIKey=FPTLXKFQHRZXNC-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=3N(C(Br)=CC2)C=CN3
Synonyms:
  • Imidazo[1,2-a]pyridine, 5-bromo-8-(phenylmethoxy)-
  • 5-Bromo-8-(phenylmethoxy)imidazo[1,2-a]pyridine
  • 8-Benzyloxy-5-bromoimidazo[1,2-a]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.