CAS 1257294-53-3
:6-Bromo-3-(phenylmethoxy)-2-pyridinamine
Description:
6-Bromo-3-(phenylmethoxy)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the bromine atom may impart specific reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The phenylmethoxy group can enhance lipophilicity, potentially influencing the compound's biological activity and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 6-Bromo-3-(phenylmethoxy)-2-pyridinamine represents a versatile structure with potential applications in drug development and chemical synthesis.
Formula:C12H11BrN2O
InChI:InChI=1S/C12H11BrN2O/c13-11-7-6-10(12(14)15-11)16-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,14,15)
InChI key:InChIKey=SBITUVUOQJQMEJ-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(N)N=C(Br)C=C2
Synonyms:- 6-Bromo-3-(phenylmethoxy)-2-pyridinamine
- 2-Pyridinamine, 6-bromo-3-(phenylmethoxy)-
- 3-(Benzyloxy)-6-bromopyridin-2-amine
- [3-[(Benzyl)oxy]-6-bromopyridin-2-yl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.