CymitQuimica logo

CAS 1257300-01-8

:

2-(4-Fluoro-2-methylphenyl)piperidine

Description:
2-(4-Fluoro-2-methylphenyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a 4-fluoro-2-methylphenyl group indicates that a fluorine atom and a methyl group are substituted on the phenyl ring, influencing the compound's electronic and steric properties. This substitution pattern can affect the compound's biological activity, solubility, and reactivity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often explored for their psychoactive and therapeutic properties. The compound's CAS number, 1257300-01-8, is a unique identifier that facilitates its identification in chemical databases and literature. Additionally, the presence of the fluorine atom may enhance lipophilicity and metabolic stability, making it a candidate for further research in drug design. Overall, the characteristics of this compound make it of interest in various fields, including organic synthesis and pharmacology.
Formula:C12H16FN
InChI:InChI=1S/C12H16FN/c1-9-8-10(13)5-6-11(9)12-4-2-3-7-14-12/h5-6,8,12,14H,2-4,7H2,1H3
InChI key:InChIKey=OSTSQXGYZFEDJR-UHFFFAOYSA-N
SMILES:CC1=C(C2CCCCN2)C=CC(F)=C1
Synonyms:
  • 2-(4-Fluoro-2-methylphenyl)piperidine
  • Piperidine, 2-(4-fluoro-2-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.