CymitQuimica logo

CAS 1257317-84-2

:

6-(3-Fluorophenyl)-1,2-dihydro-2-thioxo-3-pyridinecarbonitrile

Description:
6-(3-Fluorophenyl)-1,2-dihydro-2-thioxo-3-pyridinecarbonitrile is a chemical compound characterized by its unique structural features, which include a pyridine ring, a thioxo group, and a cyano group. The presence of the 3-fluorophenyl substituent contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of pyridine derivatives, such as moderate polarity and the ability to participate in hydrogen bonding due to the nitrogen atom in the ring. The thioxo group may impart additional reactivity, particularly in nucleophilic addition reactions. The cyano group enhances the compound's electron-withdrawing characteristics, which can influence its chemical behavior and interactions with other molecules. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in pharmaceuticals and agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would require experimental determination or literature reference for precise values.
Formula:C12H7FN2S
InChI:InChI=1S/C12H7FN2S/c13-10-3-1-2-8(6-10)11-5-4-9(7-14)12(16)15-11/h1-6H,(H,15,16)
InChI key:InChIKey=XDOPSWUQQOQDIM-UHFFFAOYSA-N
SMILES:S=C1NC(=CC=C1C#N)C2=CC(F)=CC=C2
Synonyms:
  • 6-(3-Fluorophenyl)-1,2-dihydro-2-thioxo-3-pyridinecarbonitrile
  • 3-Pyridinecarbonitrile, 6-(3-fluorophenyl)-1,2-dihydro-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.