CAS 1257329-76-2

5-(1,1,2,2,2-Pentafluoroethyl)-2-thiazolamine

Description:

5-(1,1,2,2,2-Pentafluoroethyl)-2-thiazolamine is a chemical compound characterized by its unique structure, which includes a thiazole ring and a pentafluoroethyl group. The thiazole moiety contributes to its potential biological activity, often associated with various pharmacological properties. The presence of the pentafluoroethyl group enhances the compound's lipophilicity and stability, which can influence its interaction with biological targets and its overall reactivity. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Additionally, the fluorinated carbon chain can impart unique physical properties, such as increased volatility and altered solubility in organic solvents. Its synthesis and application may be relevant in fields such as agrochemicals or pharmaceuticals. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with fluorinated compounds. As with any chemical, thorough characterization and understanding of its properties are essential for its safe and effective use in research or industrial applications.

Formula: C₅H₃F₅N₂S

InChI: InChI=1S/C5H3F5N2S/c6-4(7,5(8,9)10)2-1-12-3(11)13-2/h1H,(H2,11,12)

InChI key: InChIKey=SQJKZMLBJBUJKN-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(F)(F)C=1SC(N)=NC1

Synonyms:

• 5-(1,1,2,2,2-Pentafluoroethyl)-2-thiazolamine
• 2-Thiazolamine, 5-(1,1,2,2,2-pentafluoroethyl)-