CAS 125733-45-1
:4,8-Dimethyl-7-(2-oxiranylmethoxy)-2H-1-benzopyran-2-one
Description:
4,8-Dimethyl-7-(2-oxiranylmethoxy)-2H-1-benzopyran-2-one, identified by its CAS number 125733-45-1, is a synthetic organic compound belonging to the class of flavonoids. This compound features a benzopyran core, which is characteristic of many flavonoids, and is substituted at various positions with methyl and epoxide groups. The presence of the epoxide (oxirane) moiety suggests potential reactivity, making it interesting for various chemical transformations. The compound's structure indicates it may exhibit biological activity, possibly including antioxidant or anti-inflammatory properties, which are common in flavonoids. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its applications in pharmaceuticals or as a chemical intermediate. Additionally, the specific arrangement of substituents can affect its interaction with biological targets, making it a subject of interest in medicinal chemistry. Overall, 4,8-Dimethyl-7-(2-oxiranylmethoxy)-2H-1-benzopyran-2-one represents a unique compound with potential applications in various fields, including drug development and organic synthesis.
Formula:C14H14O4
InChI:InChI=1S/C14H14O4/c1-8-5-13(15)18-14-9(2)12(4-3-11(8)14)17-7-10-6-16-10/h3-5,10H,6-7H2,1-2H3
InChI key:InChIKey=WEYPRTGMDWTTJV-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(C)C(OCC3CO3)=CC2)OC(=O)C1
Synonyms:- 2H-1-Benzopyran-2-one, 4,8-dimethyl-7-(2-oxiranylmethoxy)-
- 4,8-Dimethyl-7-(2-oxiranylmethoxy)-2H-1-benzopyran-2-one
- 2H-1-Benzopyran-2-one, 4,8-dimethyl-7-(oxiranylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.