CAS 1257389-95-9
:Hexahydrocyclopenta[c]pyrrol-5(1H)-one
Description:
Hexahydrocyclopenta[c]pyrrol-5(1H)-one, with the CAS number 1257389-95-9, is a cyclic organic compound characterized by its unique bicyclic structure. This compound features a saturated five-membered ring fused to a six-membered ring, which contributes to its stability and reactivity. It contains a carbonyl group (C=O) that classifies it as a lactam, specifically a cyclic amide. The presence of nitrogen in the ring structure imparts basic properties, making it potentially reactive in various chemical environments. Hexahydrocyclopenta[c]pyrrol-5(1H)-one is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its physical properties, such as solubility and boiling point, can vary depending on the specific conditions and purity of the compound. Overall, this substance exemplifies the diverse chemistry of nitrogen-containing heterocycles and their significance in various chemical applications.
Formula:C7H11NO
InChI:InChI=1S/C7H11NO/c9-7-1-5-3-8-4-6(5)2-7/h5-6,8H,1-4H2
InChI key:InChIKey=XRSFPEFHACEZSM-UHFFFAOYSA-N
SMILES:O=C1CC2C(C1)CNC2
Synonyms:- Cyclopenta[c]pyrrol-5(1H)-one, hexahydro-
- 2,3,3a,4,6,6a-Hexahydro-1H-cyclopenta[c]pyrrol-5-one
- Hexahydrocyclopenta[c]pyrrol-5(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
