CymitQuimica logo

CAS 125743-66-0

:

6-Isocyano-N2,N2,N4,N4-tetramethyl-1,3,5-triazine-2,4-diamine

Description:
6-Isocyano-N2,N2,N4,N4-tetramethyl-1,3,5-triazine-2,4-diamine, with CAS number 125743-66-0, is a chemical compound characterized by its unique triazine ring structure, which is a six-membered heterocyclic compound containing three nitrogen atoms. This compound features isocyanide functional groups, contributing to its reactivity and potential applications in organic synthesis and materials science. The presence of tetramethyl substituents enhances its solubility and stability, making it suitable for various chemical reactions. Its isocyanide group is known for participating in nucleophilic addition reactions, which can be exploited in the synthesis of complex organic molecules. Additionally, the compound may exhibit interesting properties such as fluorescence or specific interactions with other chemical species, depending on its environment. Due to its structural characteristics, it may also be of interest in the development of agrochemicals or pharmaceuticals. However, handling and usage should be approached with caution, as isocyanides can be toxic and require appropriate safety measures.
Formula:C8H12N6
InChI:InChI=1S/C8H12N6/c1-9-6-10-7(13(2)3)12-8(11-6)14(4)5/h2-5H3
InChI key:InChIKey=ZDBYHTNLCPCXCN-UHFFFAOYSA-N
SMILES:N(C)(C)C=1N=C(N(C)C)N=C([N+]#[C-])N1
Synonyms:
  • 6-Isocyano-N2,N2,N4,N4-tetramethyl-1,3,5-triazine-2,4-diamine
  • 1,3,5-Triazine-2,4-diamine, 6-isocyano-N2,N2,N4,N4-tetramethyl-
  • 1,3,5-Triazine-2,4-diamine, 6-isocyano-N,N,N′,N′-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.