CymitQuimica logo

CAS 1257431-68-7

:

5-Bromo-N-methyl-3-(trifluoromethyl)-2-pyridinamine

Description:
5-Bromo-N-methyl-3-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring substituted with a bromine atom, a trifluoromethyl group, and a methylamino group. This compound is typically a solid at room temperature and may exhibit properties such as moderate solubility in polar organic solvents. The presence of the trifluoromethyl group often imparts significant lipophilicity and can enhance the compound's biological activity. The bromine atom can also influence the reactivity and stability of the molecule, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1257431-68-7, allows for easy identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, this compound's unique functional groups and structural features contribute to its potential applications in research and industry.
Formula:C7H6BrF3N2
InChI:InChI=1S/C7H6BrF3N2/c1-12-6-5(7(9,10)11)2-4(8)3-13-6/h2-3H,1H3,(H,12,13)
InChI key:InChIKey=KPIBKAFZXKJPPX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(NC)N=CC(Br)=C1
Synonyms:
  • 5-Bromo-N-methyl-3-(trifluoromethyl)-2-pyridinamine
  • (5-Bromo-3-trifluoromethyl-pyridin-2-yl)-methyl-amine
  • 2-Pyridinamine, 5-bromo-N-methyl-3-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.