CAS 1257535-08-2

2-Pyridinemethanamine, 6-fluoro-, hydrochloride (1:2)

Description:

2-Pyridinemethanamine, 6-fluoro-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 6-position of the pyridine ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and makes it suitable for various applications, including pharmaceutical formulations. The amine functional group in the compound suggests potential for hydrogen bonding and reactivity with electrophiles, making it a candidate for further chemical modifications. This compound may exhibit specific pharmacological properties, potentially influencing its use in medicinal chemistry. Its CAS number, 1257535-08-2, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, the characteristics of this compound make it of interest in both research and industrial applications.

Formula: C₆H₇FN₂·2ClH

InChI: InChI=1S/C6H7FN2.2ClH/c7-6-3-1-2-5(4-8)9-6;;/h1-3H,4,8H2;2*1H

InChI key: InChIKey=IOTYEYLCBICDEB-UHFFFAOYSA-N

SMILES: C(N)C=1N=C(F)C=CC1.Cl

Synonyms:

• 2-Pyridinemethanamine, 6-fluoro-, hydrochloride (1:2)
• (6-Fluoropyridin-2-yl)methanamine dihydrochloride

2-(Aminomethyl)-6-fluoropyridine diHCl

CAS: 1257535-08-2

Formula: C₆H₉Cl₂FN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 199.0535

Ref: IN-DA000OM9

2-(Aminomethyl)-6-fluoropyridine dihydrochloride

CAS: 1257535-08-2

2-(Aminomethyl)-6-fluoropyridine dihydrochloride

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 199.05g/mol

Ref: 54-PC8931

(6-Fluoropyridin-2-yl)methanamine dihydrochloride

CAS: 1257535-08-2

Formula: C₆H₉Cl₂FN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 199.05

Ref: 10-F239699